Chemindex > 617-05-0
KR ▼
617-05-0 Vanilicacidethylester; 97% |
|
| 상품명칭 | Vanilicacidethylester; 97% |
| 영문 이름 | Vanilicacidethylester; 97%;Vanilic acid ethyl ester;Ethyl vanillate;Ethyl 4-hydroxy-3-methoxybenzoate~Vanillic acid ethyl ester;4-Hydroxy-3-methoxybenzoic acid ethyl ester;ethyl 4-hydroxy-3-methoxybenzoate |
| 분자식 | C10H12O4 |
| 분자량 | 196.1999 |
| InChI | InChI=1/C10H12O4/c1-3-14-10(12)7-4-5-8(11)9(6-7)13-2/h4-6,11H,3H2,1-2H3 |
| cas번호 | 617-05-0 |
| EC번호 | 210-503-9 |
| 분자 구조 |  |
| 밀도 | 1.18g/cm3 |
| 녹는 점 | 39-41℃ |
| 비등점 | 292°C at 760 mmHg |
| 굴절 지수 | 1.528 |
| 인화점 | 122.4°C |
| 증기압 | 0.00108mmHg at 25°C |
| 보안 규칙 | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 