ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
616-21-7 1,2-Dichlorobutane |
|
상품명칭 | 1,2-Dichlorobutane |
영문 이름 | 1,2-Dichlorobutane;Butane, 1,2-dichloro-;HSDB 5717;NSC 93880 |
분자식 | C4H8Cl2 |
분자량 | 127.0123 |
InChI | InChI=1/C4H8Cl2/c1-2-4(6)3-5/h4H,2-3H2,1H3 |
cas번호 | 616-21-7 |
EC번호 | 210-469-5 |
분자 구조 | |
밀도 | 1.079g/cm3 |
비등점 | 122.8°C at 760 mmHg |
굴절 지수 | 1.427 |
인화점 | 27.4°C |
증기압 | 16.5mmHg at 25°C |
리스크 규칙 | R10##Flammable.:; |
보안 규칙 | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |