ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
615-94-1 2,5-Dihydroxy-1,4-benzoquinone |
|
상품명칭 | 2,5-Dihydroxy-1,4-benzoquinone |
영문 이름 | 2,5-Dihydroxy-1,4-benzoquinone;2,5-Dihydroxybenzoquinone;2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
분자식 | C6H4O4 |
분자량 | 140.0936 |
InChI | InChI=1/C6H4O4/c7-3-1-4(8)6(10)2-5(3)9/h1-2,7,10H |
cas번호 | 615-94-1 |
EC번호 | 210-454-3 |
분자 구조 | |
밀도 | 1.843g/cm3 |
녹는 점 | 220℃ |
비등점 | 322.3°C at 760 mmHg |
굴절 지수 | 1.729 |
인화점 | 162.9°C |
증기압 | 2.24E-05mmHg at 25°C |
위험성 표시 | Xn##Harmful:; |
리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
보안 규칙 | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |