2,5-Dihydroxy-1,4-benzoquinone |
상품명칭 |
2,5-Dihydroxy-1,4-benzoquinone |
영문 이름 |
2,5-Dihydroxy-1,4-benzoquinone;2,5-Dihydroxybenzoquinone;2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
분자식 |
C6H4O4 |
분자량 |
140.0936 |
InChI |
InChI=1/C6H4O4/c7-3-1-4(8)6(10)2-5(3)9/h1-2,7,10H |
cas번호 |
615-94-1 |
EC번호 |
210-454-3 |
분자 구조 |
|
밀도 |
1.843g/cm3 |
녹는 점 |
220℃ |
비등점 |
322.3°C at 760 mmHg |
굴절 지수 |
1.729 |
인화점 |
162.9°C |
증기압 |
2.24E-05mmHg at 25°C |
위험성 표시 |
Xn##Harmful:;
|
리스크 규칙 |
R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:;
|
보안 규칙 |
S36/37##Wear suitable protective clothing and gloves.:;
|
MSDS |
Material Safety Data Sheet |