ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
613-80-9 di-2-naphthyl ether |
|
상품명칭 | di-2-naphthyl ether |
영문 이름 | di-2-naphthyl ether;Dinaphthylether;2,2-Dinaphthyl ether;2-Naphthyl ether;2,2'-oxydinaphthalene |
분자식 | C20H14O |
분자량 | 270.3246 |
InChI | InChI=1/C20H14O/c1-3-7-17-13-19(11-9-15(17)5-1)21-20-12-10-16-6-2-4-8-18(16)14-20/h1-14H |
cas번호 | 613-80-9 |
EC번호 | 210-356-0 |
분자 구조 | |
밀도 | 1.184g/cm3 |
비등점 | 449.9°C at 760 mmHg |
굴절 지수 | 1.701 |
인화점 | 226.1°C |
증기압 | 7.3E-08mmHg at 25°C |
보안 규칙 | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |