2-methylquinolin-6-ol |
|
상품명칭 | 2-methylquinolin-6-ol |
영문 이름 | 2-methylquinolin-6-ol;6-Hydroxy-2-methylquinoline;2-Methyl-6-hydroxyquinoline;2-Methyl-6-hydroxyquinoine |
분자식 | C10H9NO |
분자량 | 159.1846 |
InChI | InChI=1/C10H9NO/c1-7-2-3-8-6-9(12)4-5-10(8)11-7/h2-6,12H,1H3 |
cas번호 | 613-21-8 |
분자 구조 | |
밀도 | 1.21g/cm3 |
녹는 점 | 198℃ |
비등점 | 304.5°C at 760 mmHg |
굴절 지수 | 1.666 |
인화점 | 142.3°C |
증기압 | 0.000483mmHg at 25°C |
위험성 표시 | Xi##Irritant:; |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |