ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
613-03-6 1,2,4-Triacetoxybenzene |
|
상품명칭 | 1,2,4-Triacetoxybenzene |
영문 이름 | 1,2,4-Triacetoxybenzene;1,2,4-Phenenyl triacetate;benzene-1,2,4-triyl triacetate;2-[(1-hydroxyethenyl)oxy]benzene-1,4-diyl diacetate |
분자식 | C12H12O6 |
분자량 | 252.2201 |
InChI | InChI=1/C12H12O6/c1-7(13)16-10-4-5-11(17-8(2)14)12(6-10)18-9(3)15/h4-6,15H,3H2,1-2H3 |
cas번호 | 613-03-6 |
EC번호 | 210-327-2 |
분자 구조 | ![]() |
밀도 | 1.276g/cm3 |
녹는 점 | 98-100℃ |
비등점 | 401°C at 760 mmHg |
굴절 지수 | 1.533 |
인화점 | 153.2°C |
증기압 | 3.77E-07mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |