Chemindex > 612-28-2
KR ▼
N-Methyl-2-nitroaniline |
|
| 상품명칭 | N-Methyl-2-nitroaniline |
| 영문 이름 | N-Methyl-2-nitroaniline;Benzenamine, N-methyl-2-nitro-;2-Nitro-N-methylaniline;4-12-00-01564 (Beilstein Handbook Reference);Aniline, N-methyl-o-nitro-;BRN 2209110;N-Methyl-2-nitrobenzenamine;N-Methyl-o-nitroaniline;NSC 86672;o-(Methylamino)nitrobenzene;o-Nitro-N-methylaniline |
| 분자식 | C7H8N2O2 |
| 분자량 | 152.1506 |
| InChI | InChI=1/C7H8N2O2/c1-8-6-4-2-3-5-7(6)9(10)11/h2-5,8H,1H3 |
| cas번호 | 612-28-2 |
| EC번호 | 210-303-1 |
| 분자 구조 |  |
| 밀도 | 1.26g/cm3 |
| 녹는 점 | 33-37℃ |
| 비등점 | 277.9°C at 760 mmHg |
| 굴절 지수 | 1.619 |
| 인화점 | 121.9°C |
| 증기압 | 0.0044mmHg at 25°C |
| 위험성 표시 |  T##Toxic:; |
| 리스크 규칙 | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R33##Danger of cummulative effects.:; |
| 보안 규칙 | S28A##After contact with skin, wash immediately with plenty of water.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 