ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
611-79-0 3,3'-Diaminobenzophenone |
|
상품명칭 | 3,3'-Diaminobenzophenone |
영문 이름 | 3,3'-Diaminobenzophenone;bis(3-aminophenyl)methanone |
분자식 | C13H12N2O |
분자량 | 212.2472 |
InChI | InChI=1/C13H12N2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H,14-15H2 |
cas번호 | 611-79-0 |
EC번호 | 210-281-3 |
분자 구조 | ![]() |
밀도 | 1.233g/cm3 |
비등점 | 469.4°C at 760 mmHg |
굴절 지수 | 1.673 |
인화점 | 237.7°C |
증기압 | 5.51E-09mmHg at 25°C |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |