ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
611-23-4 2-Nitrosotoluene |
|
상품명칭 | 2-Nitrosotoluene |
영문 이름 | 2-Nitrosotoluene;1-Methyl-2-nitrosobenzene;2-Methyl-1-nitrosobenzene;2-Methylnitrosobenzene;4-05-00-00844 (Beilstein Handbook Reference);BRN 1927295;CCRIS 480;NSC 66507;o-Methylnitrosobenzene;o-Nitrosotoluene;Benzene, 1-methyl-2-nitroso- (9CI);Toluene, o-nitroso- |
분자식 | C7H7NO |
분자량 | 121.1366 |
InChI | InChI=1/C7H7NO/c1-6-4-2-3-5-7(6)8-9/h2-5H,1H3 |
cas번호 | 611-23-4 |
EC번호 | 210-261-4 |
분자 구조 | |
밀도 | 1.03g/cm3 |
녹는 점 | 70-75℃ |
비등점 | 199.9°C at 760 mmHg |
굴절 지수 | 1.524 |
인화점 | 74.7°C |
증기압 | 0.472mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |