Chemindex > 611-15-4
KR ▼
o-Vinyltoluene |
|
| 상품명칭 | o-Vinyltoluene |
| 영문 이름 | o-Vinyltoluene;2-Methylstyrene;2-Vinyltoluene |
| 분자식 | C9H10 |
| 분자량 | 118.17 |
| InChI | InChI=1/C9H10/c1-3-9-7-5-4-6-8(9)2/h3-7H,1H2,2H3 |
| cas번호 | 611-15-4 |
| EC번호 | 210-256-7 |
| 분자 구조 |  |
| 밀도 | 0.916 |
| 리스크 규칙 | R20##Harmful by inhalation.||R51/53##Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.:; |
| 보안 규칙 | S24##Avoid contact with skin.||S61##Avoid release to the environment. Refer to special instructions / Safety data sheets.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.ChemNet Mall을 방문하여
o-Vinyltoluene 611-15-4 의 가격에 대해 문의하십시오.
611-15-4 (0) 공급 업체:
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 