ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
610-34-4 Ethyl 2-nitrobenzoate |
|
상품명칭 | Ethyl 2-nitrobenzoate |
영문 이름 | Ethyl 2-nitrobenzoate;2-Nitrobenzoic acid ethyl ester |
분자식 | C9H9NO4 |
분자량 | 195.1721 |
InChI | InChI=1/C9H9NO4/c1-2-14-9(11)7-5-3-4-6-8(7)10(12)13/h3-6H,2H2,1H3 |
cas번호 | 610-34-4 |
EC번호 | 210-220-0 |
분자 구조 | |
밀도 | 1.253g/cm3 |
녹는 점 | 26-174℃ |
비등점 | 275°C at 760 mmHg |
굴절 지수 | 1.544 |
인화점 | 126.1°C |
증기압 | 0.00523mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |