ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
608-28-6 2-Iodo-m-xylene |
|
상품명칭 | 2-Iodo-m-xylene |
영문 이름 | 2-Iodo-m-xylene;2-Iodo-1,3-Dimethylbenzene |
분자식 | C8H9I |
분자량 | 232.0615 |
InChI | InChI=1/C8H9I/c1-6-4-3-5-7(2)8(6)9/h3-5H,1-2H3 |
cas번호 | 608-28-6 |
EC번호 | 210-158-4 |
분자 구조 | ![]() |
밀도 | 1.61g/cm3 |
비등점 | 227.5°C at 760 mmHg |
굴절 지수 | 1.592 |
인화점 | 98.1°C |
물 용해도 | insoluble |
증기압 | 0.116mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection:; |
MSDS |