Methyl 2-nitrobenzoate |
|
상품명칭 | Methyl 2-nitrobenzoate |
영문 이름 | Methyl 2-nitrobenzoate;2-Nitrobenzoic acid methyl ester |
분자식 | C8H7NO4 |
분자량 | 181.1455 |
InChI | InChI=1/C8H7NO4/c1-13-8(10)6-4-2-3-5-7(6)9(11)12/h2-5H,1H3 |
cas번호 | 606-27-9 |
EC번호 | 210-111-8 |
분자 구조 | |
밀도 | 1.301g/cm3 |
녹는 점 | -13℃ |
비등점 | 275°C at 760 mmHg |
굴절 지수 | 1.553 |
인화점 | 124.8°C |
증기압 | 0.00523mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |