ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
605-62-9 4-Nitro-1-Naphthol |
|
상품명칭 | 4-Nitro-1-Naphthol |
영문 이름 | 4-Nitro-1-Naphthol;4-nitronaphthalen-1-ol |
분자식 | C10H7NO3 |
분자량 | 189.1675 |
InChI | InChI=1/C10H7NO3/c12-10-6-5-9(11(13)14)7-3-1-2-4-8(7)10/h1-6,12H |
cas번호 | 605-62-9 |
분자 구조 | ![]() |
밀도 | 1.413g/cm3 |
비등점 | 398.8°C at 760 mmHg |
굴절 지수 | 1.714 |
인화점 | 179.8°C |
증기압 | 6.25E-07mmHg at 25°C |
리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
보안 규칙 | S28##After contact with skin, wash immediately with plenty of ...||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |