Chemindex > 605-62-9
KR ▼
605-62-9 4-Nitro-1-Naphthol |
|
| 상품명칭 | 4-Nitro-1-Naphthol |
| 영문 이름 | 4-Nitro-1-Naphthol;4-nitronaphthalen-1-ol |
| 분자식 | C10H7NO3 |
| 분자량 | 189.1675 |
| InChI | InChI=1/C10H7NO3/c12-10-6-5-9(11(13)14)7-3-1-2-4-8(7)10/h1-6,12H |
| cas번호 | 605-62-9 |
| 분자 구조 |  |
| 밀도 | 1.413g/cm3 |
| 비등점 | 398.8°C at 760 mmHg |
| 굴절 지수 | 1.714 |
| 인화점 | 179.8°C |
| 증기압 | 6.25E-07mmHg at 25°C |
| 리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| 보안 규칙 | S28##After contact with skin, wash immediately with plenty of ...||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 