ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
603-80-5 3-Hydroxy-2-Methyl Benzoic Acid |
|
상품명칭 | 3-Hydroxy-2-Methyl Benzoic Acid |
영문 이름 | 3-Hydroxy-2-Methyl Benzoic Acid;3-Hydroxy-2-methylbenzoic acid;Hydroxytoluicacid;3-Hydroxy-o-toluic acid;2-methyl-3-hydroxybenzoic acid;3-hydroxy-2-methylbenzoate;2-Methyl-3-hydroxy benzoic acid |
분자식 | C8H7O3 |
분자량 | 151.1399 |
InChI | InChI=1/C8H8O3/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4,9H,1H3,(H,10,11)/p-1 |
cas번호 | 603-80-5 |
분자 구조 | |
녹는 점 | 143-148℃ |
비등점 | 336.6°C at 760 mmHg |
인화점 | 171.6°C |
증기압 | 4.36E-05mmHg at 25°C |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |