Chemindex > 603-10-1
KR ▼
603-10-1 2,3,6-trinitrophenol moistened with water (H2O ~40%) |
|
| 상품명칭 | 2,3,6-trinitrophenol moistened with water (H2O ~40%) |
| 영문 이름 | 2,3,6-trinitrophenol moistened with water (H2O ~40%); |
| 분자식 | C6H3N3O7 |
| 분자량 | 229.1039 |
| InChI | InChI=1/C6H3N3O7/c10-6-4(8(13)14)2-1-3(7(11)12)5(6)9(15)16/h1-2,10H |
| cas번호 | 603-10-1 |
| 분자 구조 |  |
| 밀도 | 1.856g/cm3 |
| 녹는 점 | 119-120℃ |
| 비등점 | 337.9°C at 760 mmHg |
| 굴절 지수 | 1.701 |
| 인화점 | 151.1°C |
| 증기압 | 5.2E-05mmHg at 25°C |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
603-10-1 (0) 공급 업체:
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 