Chemindex > 602-87-9
KR ▼
602-87-9 5-Nitroacenaphthene |
|
| 상품명칭 | 5-Nitroacenaphthene |
| 영문 이름 | 5-Nitroacenaphthene;1,2-Dihydro-5-nitro-acenaphthylene;4-05-00-01840 (Beilstein Handbook Reference);5-Nan;5-Nitroacenaphthylene;5-Nitroacenapthene;5-Nitronaphthalene;5-Nitronaphthalene ethylene;Acenaphthene, 5-nitro-;Acenaphthylene, 1,2-dihydro-5-nitro-;BRN 1876864;CCRIS 438;HSDB 4092;NCI-C01967;NSC 1312;NSC 22421;1,2-Dihydro-5-nitroacenaphthylene;5-nitro-1,2-dihydroacenaphthylene;Nitroacenaphthene;1,2-dihydro-5-nitro-acenaphthylen |
| 분자식 | C12H7NO2 |
| 분자량 | 197.1895 |
| InChI | InChI=1/C12H7NO2/c14-13(15)11-7-6-9-5-4-8-2-1-3-10(11)12(8)9/h1-7H |
| cas번호 | 602-87-9 |
| EC번호 | 210-025-0 |
| 분자 구조 |  |
| 밀도 | 1.408g/cm3 |
| 녹는 점 | 101-102℃ |
| 비등점 | 381.6°C at 760 mmHg |
| 굴절 지수 | 1.763 |
| 인화점 | 196.7°C |
| 증기압 | 1.1E-05mmHg at 25°C |
| 리스크 규칙 | R45##May cause cancer.:; |
| 보안 규칙 | S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S53##Avoid exposure - obtain special instructions before use.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 