ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
602-87-9 5-Nitroacenaphthene |
|
상품명칭 | 5-Nitroacenaphthene |
영문 이름 | 5-Nitroacenaphthene;1,2-Dihydro-5-nitro-acenaphthylene;4-05-00-01840 (Beilstein Handbook Reference);5-Nan;5-Nitroacenaphthylene;5-Nitroacenapthene;5-Nitronaphthalene;5-Nitronaphthalene ethylene;Acenaphthene, 5-nitro-;Acenaphthylene, 1,2-dihydro-5-nitro-;BRN 1876864;CCRIS 438;HSDB 4092;NCI-C01967;NSC 1312;NSC 22421;1,2-Dihydro-5-nitroacenaphthylene;5-nitro-1,2-dihydroacenaphthylene;Nitroacenaphthene;1,2-dihydro-5-nitro-acenaphthylen |
분자식 | C12H7NO2 |
분자량 | 197.1895 |
InChI | InChI=1/C12H7NO2/c14-13(15)11-7-6-9-5-4-8-2-1-3-10(11)12(8)9/h1-7H |
cas번호 | 602-87-9 |
EC번호 | 210-025-0 |
분자 구조 | ![]() |
밀도 | 1.408g/cm3 |
녹는 점 | 101-102℃ |
비등점 | 381.6°C at 760 mmHg |
굴절 지수 | 1.763 |
인화점 | 196.7°C |
증기압 | 1.1E-05mmHg at 25°C |
리스크 규칙 | R45##May cause cancer.:; |
보안 규칙 | S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S53##Avoid exposure - obtain special instructions before use.:; |
MSDS |