Chemindex > 602-00-6
KR ▼
602-00-6 3-Hydroxy-2-nitrobenzoic acid |
|
| 상품명칭 | 3-Hydroxy-2-nitrobenzoic acid |
| 영문 이름 | 3-Hydroxy-2-nitrobenzoic acid; |
| 분자식 | C7H5NO5 |
| 분자량 | 183.1183 |
| InChI | InChI=1/C7H5NO5/c9-5-3-1-2-4(7(10)11)6(5)8(12)13/h1-3,9H,(H,10,11) |
| cas번호 | 602-00-6 |
| 분자 구조 |  |
| 밀도 | 1.631g/cm3 |
| 비등점 | 362.9°C at 760 mmHg |
| 굴절 지수 | 1.663 |
| 인화점 | 166.7°C |
| 증기압 | 6.68E-06mmHg at 25°C |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 