Chemindex > 5989-27-5
KR ▼
5989-27-5 (+)-Limonene |
|
| 상품명칭 | (+)-Limonene |
| 영문 이름 | (+)-Limonene;D-Limonene;Limonene 145;(R)-p-mentha-1,8-diene;(R)-(+)-4-Isopropenyl-1-methylcyclohexene;(+)-p-Mentha-1,8-diene;(4R)-1-methyl-4-(prop-1-en-2-yl)cyclohexene |
| 분자식 | C10H16 |
| 분자량 | 136.234 |
| InChI | InChI=1/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3/t10-/m0/s1 |
| cas번호 | 5989-27-5 |
| EC번호 | 227-813-5 |
| 분자 구조 |  |
| 밀도 | 0.834g/cm3 |
| 녹는 점 | -74℃ |
| 비등점 | 175.4°C at 760 mmHg |
| 굴절 지수 | 1.467 |
| 인화점 | 42.8°C |
| 증기압 | 1.54mmHg at 25°C |
| 위험성 표시 |  Xi##Irritant||N##Dangerous for the environment:; |
| 리스크 규칙 | R10##Flammable.||R38##Irritating to skin.||R43##May cause sensitization by skin contact.||R50/53##Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.:; |
| 보안 규칙 | S24##Avoid contact with skin.||S37##Wear suitable gloves.||S60##This material and its container must be disposed of as hazardous waste.||S61##Avoid release to the environment. Refer to special instructions / Safety data sheets.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 