ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59-85-8 4-(chloromercurio)benzoic acid |
|
상품명칭 | 4-(chloromercurio)benzoic acid |
영문 이름 | 4-(chloromercurio)benzoic acid;4-chloromercuriobenzoic acid;4-Chloromercuribenzoic acid;(4-carboxyphenyl)(chloro)mercury;(4-carboxyphenyl)mercury(1+) chloride |
분자식 | C7H5ClHgO2 |
분자량 | 357.1564 |
InChI | InChI=1/C7H5O2.ClH.Hg/c8-7(9)6-4-2-1-3-5-6;;/h2-5H,(H,8,9);1H;/q;;+1/p-1/rC7H5HgO2.ClH/c8-6-3-1-5(2-4-6)7(9)10;/h1-4H,(H,9,10);1H/q+1;/p-1 |
cas번호 | 59-85-8 |
EC번호 | 200-442-6 |
분자 구조 | ![]() |
녹는 점 | 300℃ |
리스크 규칙 | R26/27/28##Very toxic by inhalation, in contact with skin and if swallowed.||R33##Danger of cummulative effects.:; |
보안 규칙 | S13##Keep away from food, drink and animal feeding stuffs.||S28##After contact with skin, wash immediately with plenty of ...||S36##Wear suitable protective clothing.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |