5-Nitro-2-furonitrile |
|
상품명칭 | 5-Nitro-2-furonitrile |
영문 이름 | 5-Nitro-2-furonitrile;5-Nitro-2-furancarbonitrile;5-nitrofuran-2-carbonitrile |
분자식 | C5H2N2O3 |
분자량 | 138.081 |
InChI | InChI=1/C5H2N2O3/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
cas번호 | 59-82-5 |
분자 구조 | |
밀도 | 1.46g/cm3 |
비등점 | 234.7°C at 760 mmHg |
굴절 지수 | 1.544 |
인화점 | 95.7°C |
증기압 | 0.0522mmHg at 25°C |
리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
보안 규칙 | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |