Chemindex > 578-46-1
KR ▼
578-46-1 5-Methyl-2-nitroaniline |
|
| 상품명칭 | 5-Methyl-2-nitroaniline |
| 영문 이름 | 5-Methyl-2-nitroaniline;3-Amino-4-nitrotoluene;6-Nitro-m-toluidine;5-Methyl-2-nitrophenylamine;5-Methyl-2-nitro phenylamine |
| 분자식 | C7H8N2O2 |
| 분자량 | 152.1506 |
| InChI | InChI=1/C7H8N2O2/c1-5-2-3-7(9(10)11)6(8)4-5/h2-4H,8H2,1H3 |
| cas번호 | 578-46-1 |
| EC번호 | 209-423-7 |
| 분자 구조 |  |
| 밀도 | 1.269g/cm3 |
| 비등점 | 312.4°C at 760 mmHg |
| 굴절 지수 | 1.615 |
| 인화점 | 142.8°C |
| 증기압 | 0.000529mmHg at 25°C |
| 리스크 규칙 | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R33##Danger of cummulative effects.||R51/53##Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.:; |
| 보안 규칙 | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S61##Avoid release to the environment. Refer to special instructions / Safety data sheets.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 