ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54792-21-1 4-(2,4-dichlorophenoxy)butyric acid, compound with 2,2'-iminodiethanol (1:1) |
|
상품명칭 | 4-(2,4-dichlorophenoxy)butyric acid, compound with 2,2'-iminodiethanol (1:1) |
영문 이름 | 4-(2,4-dichlorophenoxy)butyric acid, compound with 2,2'-iminodiethanol (1:1);4-(2,4-Dichlorophenoxy)butyric acid, compound with 2,2'-iminodiethanol (1:1);4-(2,4-dichlorophenoxy)butanoic acid - 2,2'-iminodiethanol (1:1) |
분자식 | C14H21Cl2NO5 |
분자량 | 354.2262 |
InChI | InChI=1/C10H10Cl2O3.C4H11NO2/c11-7-3-4-9(8(12)6-7)15-5-1-2-10(13)14;6-3-1-5-2-4-7/h3-4,6H,1-2,5H2,(H,13,14);5-7H,1-4H2 |
cas번호 | 54792-21-1 |
EC번호 | 259-353-6 |
분자 구조 | |
비등점 | 410.4°C at 760 mmHg |
인화점 | 202°C |
증기압 | 1.8E-07mmHg at 25°C |
MSDS |