ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54-88-6 4-디메틸아미노-2-메틸라조벤젠 |
|
상품명칭 | 4-디메틸아미노-2-메틸라조벤젠 |
별명 | ; N,N-디메틸-4-페닐라조-m-톨루이딘; N, N, 3- 트리메틸 -4- [(E) - 페닐 디아 제닐] 아닐린; |
영문 이름 | 4-Dimethylamino-2-methylazobenzene;N,N-Dimethyl-4-phenylazo-m-toluidine;N,N,3-trimethyl-4-[(E)-phenyldiazenyl]aniline |
분자식 | C15H17N3 |
분자량 | 239.3156 |
InChI | InChI=1/C15H17N3/c1-12-11-14(18(2)3)9-10-15(12)17-16-13-7-5-4-6-8-13/h4-11H,1-3H3/b17-16+ |
cas번호 | 54-88-6 |
EC번호 | 200-217-2 |
분자 구조 | |
밀도 | 1.01g/cm3 |
녹는 점 | 65-68℃ |
비등점 | 390.9°C at 760 mmHg |
굴절 지수 | 1.561 |
인화점 | 190.2°C |
증기압 | 2.57E-06mmHg at 25°C |
위험성 표시 | T##Toxic:; |
리스크 규칙 | R23/24##Toxic by inhalation and in contact with skin.||R33##Danger of cummulative effects.:; |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |