ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
53-96-3 2-Acetamidofluorene |
|
상품명칭 | 2-Acetamidofluorene |
영문 이름 | 2-Acetamidofluorene;N-(2-Fluorenyl)acetamide;Acetamidofluorene;N-(9H-fluoren-2-yl)acetamide;2-(9H-fluoren-2-yl)acetamide |
분자식 | C15H13NO |
분자량 | 223.2698 |
InChI | InChI=1/C15H13NO/c16-15(17)8-10-5-6-14-12(7-10)9-11-3-1-2-4-13(11)14/h1-7H,8-9H2,(H2,16,17) |
cas번호 | 53-96-3 |
EC번호 | 200-188-6 |
분자 구조 | ![]() |
밀도 | 1.227g/cm3 |
녹는 점 | 192-196℃ |
비등점 | 471.2°C at 760 mmHg |
굴절 지수 | 1.656 |
인화점 | 238.8°C |
물 용해도 | 0.000529 g/100 mL |
증기압 | 4.73E-09mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R46##May cause heritable genetic damages.:; |
보안 규칙 | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |