ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52805-36-4 4-Benzyloxybenzonitrile |
|
상품명칭 | 4-Benzyloxybenzonitrile |
영문 이름 | 4-Benzyloxybenzonitrile; |
분자식 | C14H11NO |
분자량 | 209.2432 |
InChI | InChI=1/C14H11NO/c15-10-12-6-8-14(9-7-12)16-11-13-4-2-1-3-5-13/h1-9H,11H2 |
cas번호 | 52805-36-4 |
분자 구조 | |
밀도 | 1.14g/cm3 |
비등점 | 374°C at 760 mmHg |
굴절 지수 | 1.597 |
인화점 | 157.6°C |
증기압 | 8.61E-06mmHg at 25°C |
리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
보안 규칙 | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |