Chemindex > 519-05-1
KR ▼
2-Carboxy-3,4-dimethoxybenzaldehyde |
|
| 상품명칭 | 2-Carboxy-3,4-dimethoxybenzaldehyde |
| 영문 이름 | 2-Carboxy-3,4-dimethoxybenzaldehyde;5,6-Dimethoxyphthalaldehydic acid~6-Formyl-2,3-dimethoxybenzoic acid~Opianic acid;6-formyl-2,3-dimethoxybenzoic acid |
| 분자식 | C10H10O5 |
| 분자량 | 210.1834 |
| InChI | InChI=1/C10H10O5/c1-14-7-4-3-6(5-11)8(10(12)13)9(7)15-2/h3-5H,1-2H3,(H,12,13) |
| cas번호 | 519-05-1 |
| EC번호 | 208-261-4 |
| 분자 구조 |  |
| 밀도 | 1.3g/cm3 |
| 비등점 | 386.3°C at 760 mmHg |
| 굴절 지수 | 1.573 |
| 인화점 | 155.1°C |
| 증기압 | 1.17E-06mmHg at 25°C |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
519-05-1 (0) 공급 업체:
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 