ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
513-86-0 Acetyl methyl carbinol |
|
상품명칭 | Acetyl methyl carbinol |
영문 이름 | Acetyl methyl carbinol;3-Hydroxy-2-butanone;acetoin, mixture of monomer and dimer;Acetoin (3-Hydroxy-2-butanone);1-acetylethanol;Acetoin;3-hydroxybutan-2-one;(3R)-3-hydroxybutan-2-one;(3S)-3-hydroxybutan-2-one;Acetoion;Acetion |
분자식 | C4H8O2 |
분자량 | 88.1051 |
InChI | InChI=1/C4H8O2/c1-3(5)4(2)6/h3,5H,1-2H3/t3-/m0/s1 |
cas번호 | 513-86-0 |
EC번호 | 208-174-1 |
분자 구조 | ![]() |
밀도 | 0.983g/cm3 |
녹는 점 | 15℃ |
비등점 | 145.4°C at 760 mmHg |
굴절 지수 | 1.408 |
인화점 | 49.7°C |
물 용해도 | SOLUBLE |
증기압 | 1.92mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R10||R36/38:; |
보안 규칙 | S26||S36/37:; |
MSDS |