Chemindex > 513-81-5
KR ▼
2,3-Dimethylbutadiene-1,3 |
|
| 상품명칭 | 2,3-Dimethylbutadiene-1,3 |
| 영문 이름 | 2,3-Dimethylbutadiene-1,3;2,3-Dimethyl-1,3-butadiene;2,3-dimethylbuta-1,3-diene |
| 분자식 | C6H10 |
| 분자량 | 82.1436 |
| InChI | InChI=1/C6H10/c1-5(2)6(3)4/h1,3H2,2,4H3 |
| cas번호 | 513-81-5 |
| EC번호 | 208-172-0 |
| 분자 구조 |  |
| 밀도 | 0.699g/cm3 |
| 비등점 | 68.8°C at 760 mmHg |
| 굴절 지수 | 1.408 |
| 증기압 | 150mmHg at 25°C |
| 리스크 규칙 | R11##Highly flammable.||R65##Harmful: may cause lung damage if swallowed.:; |
| 보안 규칙 | S16##Keep away from sources of ignition - No smoking.||S23##Do not inhale gas/fumes/vapour/spray.||S33##Take precautionary measures against static discharges.||S62##If swallowed, do not induce vomiting: seek medical advice immediately and show this container or label.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
513-81-5 (0) 공급 업체:
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 