ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51-18-3 Triethylenemelamine |
|
상품명칭 | Triethylenemelamine |
영문 이름 | Triethylenemelamine;Tretamine;2,4,6-tri(aziridin-1-yl)-1,3,5-triazine;2,4,6-Tris(1-aziridinyl)-s-triazine;TEM;2,4,6-tris(aziridin-1-yl)-1,3,5-triazine |
분자식 | C9H12N6 |
분자량 | 204.2318 |
InChI | InChI=1/C9H12N6/c1-2-13(1)7-10-8(14-3-4-14)12-9(11-7)15-5-6-15/h1-6H2 |
cas번호 | 51-18-3 |
EC번호 | 200-083-5 |
분자 구조 | ![]() |
밀도 | 1.617g/cm3 |
녹는 점 | 160℃ |
비등점 | 430.2°C at 760 mmHg |
굴절 지수 | 1.789 |
인화점 | 214°C |
증기압 | 1.32E-07mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R28##Very toxic if swallowed.||R40##Possible risks of irreversible effects.:; |
보안 규칙 | S24/25##Avoid contact with skin and eyes.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |