ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
506-50-3 Triacontanoic acid |
|
상품명칭 | Triacontanoic acid |
영문 이름 | Triacontanoic acid; |
분자식 | C30H60O2 |
분자량 | 452.7962 |
InChI | InChI=1/C30H60O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29-30(31)32/h2-29H2,1H3,(H,31,32) |
cas번호 | 506-50-3 |
EC번호 | 208-042-3 |
분자 구조 | |
밀도 | 0.873g/cm3 |
녹는 점 | 91-94℃ |
비등점 | 441.4°C at 760 mmHg |
굴절 지수 | 1.462 |
인화점 | 196.9°C |
증기압 | 1.44E-08mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |