ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50533-97-6 4-dimethylaminopiperidine |
|
상품명칭 | 4-dimethylaminopiperidine |
영문 이름 | 4-dimethylaminopiperidine;4-(Dimethylamino)piperidine;N,N-dimethylpiperidin-4-amine |
분자식 | C7H16N2 |
분자량 | 128.2153 |
InChI | InChI=1/C7H16N2/c1-9(2)7-3-5-8-6-4-7/h7-8H,3-6H2,1-2H3 |
cas번호 | 50533-97-6 |
EC번호 | 256-617-2 |
분자 구조 | |
밀도 | 0.91g/cm3 |
비등점 | 179.7°C at 760 mmHg |
굴절 지수 | 1.479 |
인화점 | 63.3°C |
증기압 | 0.929mmHg at 25°C |
리스크 규칙 | R10##Flammable.||R34##Causes burns.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |