ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50-66-8 6-(Methylthio)purine |
|
상품명칭 | 6-(Methylthio)purine |
영문 이름 | 6-(Methylthio)purine;6-(Methylmercapto)purine;6-(Methylsulfanyl)-9H-purine;6-(methylsulfanyl)-7H-purine;6-(methylsulfanyl)-5H-purine |
분자식 | C6H6N4S |
분자량 | 166.2036 |
InChI | InChI=1/C6H6N4S/c1-11-6-4-5(8-2-7-4)9-3-10-6/h2-4H,1H3 |
cas번호 | 50-66-8 |
EC번호 | 200-057-3 |
분자 구조 | ![]() |
밀도 | 1.59g/cm3 |
녹는 점 | 221-222℃ |
비등점 | 290.9°C at 760 mmHg |
굴절 지수 | 1.806 |
인화점 | 129.7°C |
증기압 | 0.00351mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |