Chemindex > 499771-17-4
KR ▼
499771-17-4 2- [4- (2,3- 디 하이드로 -1,4- 벤조 다이옥신 -6- 일) -1,3- 티아 졸 -2- 일] 아세토 니트릴 |
|
| 상품명칭 | 2- [4- (2,3- 디 하이드로 -1,4- 벤조 다이옥신 -6- 일) -1,3- 티아 졸 -2- 일] 아세토 니트릴 |
| 별명 | [4- (2,3- 디 하이드로 -1,4- 벤조 다이옥신 -6- 일) -1,3- 티아 졸 -2- 일] 아세토 니트릴; |
| 영문 이름 | 2-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]acetonitrile;[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]acetonitrile |
| 분자식 | C13H10N2O2S |
| 분자량 | 258.2957 |
| InChI | InChI=1/C13H10N2O2S/c14-4-3-13-15-10(8-18-13)9-1-2-11-12(7-9)17-6-5-16-11/h1-2,7-8H,3,5-6H2 |
| cas번호 | 499771-17-4 |
| 분자 구조 | ![499771-17-4 2- [4- (2,3- 디 하이드로 -1,4- 벤조 다이옥신 -6- 일) -1,3- 티아 졸 -2- 일] 아세토 니트릴](https://images-a.chemnet.com/suppliers/chembase/241/116241.gif "499771-17-4 2- [4- (2,3- 디 하이드로 -1,4- 벤조 다이옥신 -6- 일) -1,3- 티아 졸 -2- 일] 아세토 니트릴") |
| 밀도 | 1.341g/cm3 |
| 녹는 점 | 115℃ |
| 비등점 | 456.2°C at 760 mmHg |
| 굴절 지수 | 1.619 |
| 인화점 | 229.7°C |
| 증기압 | 1.65E-08mmHg at 25°C |
| 위험성 표시 |  Xn##Harmful:; |
| 리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| 보안 규칙 | S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
499771-17-4 (0) 공급 업체:
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 