ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
459-59-6 4-Fluoro-N-methylaniline |
|
상품명칭 | 4-Fluoro-N-methylaniline |
영문 이름 | 4-Fluoro-N-methylaniline;4-Fluoro-N-toluidine |
분자식 | C7H8FN |
분자량 | 125.1435 |
InChI | InChI=1/C7H8FN/c1-9-7-4-2-6(8)3-5-7/h2-5,9H,1H3 |
cas번호 | 459-59-6 |
EC번호 | 207-294-1 |
분자 구조 | ![]() |
밀도 | 1.106g/cm3 |
비등점 | 181.4°C at 760 mmHg |
굴절 지수 | 1.546 |
인화점 | 63.5°C |
증기압 | 0.853mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |