Chemindex > 458-05-9
KR ▼
1-(3-fluorophenyl)-2-thiourea |
|
| 상품명칭 | 1-(3-fluorophenyl)-2-thiourea |
| 영문 이름 | 1-(3-fluorophenyl)-2-thiourea;3-Fluorophenylthiourea;1-(3-fluorophenyl)thiourea |
| 분자식 | C7H7FN2S |
| 분자량 | 170.2073 |
| InChI | InChI=1/C7H7FN2S/c8-5-2-1-3-6(4-5)10-7(9)11/h1-4H,(H3,9,10,11) |
| cas번호 | 458-05-9 |
| 분자 구조 |  |
| 밀도 | 1.397g/cm3 |
| 비등점 | 259.3°C at 760 mmHg |
| 굴절 지수 | 1.692 |
| 인화점 | 110.6°C |
| 증기압 | 0.0131mmHg at 25°C |
| 리스크 규칙 | R25##Toxic if swallowed.:; |
| 보안 규칙 | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 