Chemindex > 455-84-5
KR ▼
455-84-5 4-Fluoro-3-methylbenzoyl chloride |
|
| 상품명칭 | 4-Fluoro-3-methylbenzoyl chloride |
| 영문 이름 | 4-Fluoro-3-methylbenzoyl chloride;4-Fluoro-m-toluoyl chloride |
| 분자식 | C8H6ClFO |
| 분자량 | 172.584 |
| InChI | InChI=1/C8H6ClFO/c1-5-4-6(8(9)11)2-3-7(5)10/h2-4H,1H3 |
| cas번호 | 455-84-5 |
| 분자 구조 |  |
| 밀도 | 1.265g/cm3 |
| 비등점 | 214.1°C at 760 mmHg |
| 굴절 지수 | 1.518 |
| 인화점 | 83.3°C |
| 증기압 | 0.158mmHg at 25°C |
| 리스크 규칙 | R34##Causes burns.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 