ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
455-37-8 3-fluorobenzamide |
|
상품명칭 | 3-fluorobenzamide |
영문 이름 | 3-fluorobenzamide;m-Fluorobenzamide |
분자식 | C7H6FNO |
분자량 | 139.127 |
InChI | InChI=1/C7H6FNO/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,(H2,9,10) |
cas번호 | 455-37-8 |
EC번호 | 207-247-5 |
분자 구조 | ![]() |
밀도 | 1.238g/cm3 |
녹는 점 | 129-132℃ |
비등점 | 238.4°C at 760 mmHg |
굴절 지수 | 1.538 |
인화점 | 98°C |
증기압 | 0.0426mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |