ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
454-29-5 DL-Homocysteine |
|
상품명칭 | DL-Homocysteine |
영문 이름 | DL-Homocysteine;DL-Homocysteine 2-Amino-4-mercaptobuyric acid;homocysteine;D-homocysteine |
분자식 | C4H9NO2S |
분자량 | 135.1848 |
InChI | InChI=1/C4H9NO2S/c5-3(1-2-8)4(6)7/h3,8H,1-2,5H2,(H,6,7)/t3-/m1/s1 |
cas번호 | 454-29-5 |
EC번호 | 207-222-9 |
분자 구조 | ![]() |
밀도 | 1.259g/cm3 |
녹는 점 | 232-233℃ |
비등점 | 299.7°C at 760 mmHg |
굴절 지수 | 1.537 |
인화점 | 135°C |
증기압 | 0.000278mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |