ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
453-13-4 1,3-difluoro-2-propanol |
|
상품명칭 | 1,3-difluoro-2-propanol |
영문 이름 | 1,3-difluoro-2-propanol;Geiftor;1,3-difluoropropan-2-one |
분자식 | C3H4F2O |
분자량 | 94.0601 |
InChI | InChI=1/C3H4F2O/c4-1-3(6)2-5/h1-2H2 |
cas번호 | 453-13-4 |
EC번호 | 207-216-6 |
분자 구조 | ![]() |
밀도 | 1.092g/cm3 |
비등점 | 85.7°C at 760 mmHg |
굴절 지수 | 1.304 |
인화점 | 22°C |
증기압 | 68.5mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R10##Flammable.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S16##Keep away from sources of ignition - No smoking.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |