ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
452-68-6 2-Fluoro-5-Iodotoluene |
|
상품명칭 | 2-Fluoro-5-Iodotoluene |
영문 이름 | 2-Fluoro-5-Iodotoluene; |
분자식 | C7H6FI |
분자량 | 236.02 |
InChI | InChI=1/C7H6FI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
cas번호 | 452-68-6 |
EC번호 | 207-206-1 |
분자 구조 | |
리스크 규칙 | R36/38##Irritating to eyes and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |