ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
447-53-0 1,2-Dihydronaphthalene |
|
상품명칭 | 1,2-Dihydronaphthalene |
영문 이름 | 1,2-Dihydronaphthalene;1,2-DIHYDRONAPHTHALENE;naphthalene, 1,2-dihydro- |
분자식 | C10H10 |
분자량 | 130.1864 |
InChI | InChI=1/C10H10/c1-2-6-10-8-4-3-7-9(10)5-1/h1-3,5-7H,4,8H2 |
cas번호 | 447-53-0 |
EC번호 | 207-183-8 |
분자 구조 | |
밀도 | 1.004g/cm3 |
녹는 점 | -8℃ |
비등점 | 204.9°C at 760 mmHg |
굴절 지수 | 1.572 |
인화점 | 70.4°C |
증기압 | 0.367mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |