ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
447-31-4 Desyl chloride |
|
상품명칭 | Desyl chloride |
영문 이름 | Desyl chloride;alpha-Chloro-alpha-phenylacetophenone;alpha-chlorodeoxybenzoin;2-chloro-1,2-diphenylethanone;(2R)-2-chloro-1,2-diphenylethanone;(2S)-2-chloro-1,2-diphenylethanone |
분자식 | C14H11ClO |
분자량 | 230.6895 |
InChI | InChI=1/C14H11ClO/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13H/t13-/m0/s1 |
cas번호 | 447-31-4 |
EC번호 | 207-181-7 |
분자 구조 | |
밀도 | 1.19g/cm3 |
녹는 점 | 65-69℃ |
비등점 | 345.5°C at 760 mmHg |
굴절 지수 | 1.592 |
인화점 | 190.4°C |
증기압 | 6.14E-05mmHg at 25°C |
위험성 표시 | Xn##Harmful:; |
리스크 규칙 | R20/21##Harmful by inhalation and in contact with skin.||R37##Irritating to respiratory system.:; |
보안 규칙 | S22##Do not inhale dust.||S24##Avoid contact with skin.:; |
MSDS |