Chemindex > 446-22-0
KR ▼
446-22-0 2'-fluoropropiophenone |
|
| 상품명칭 | 2'-fluoropropiophenone |
| 영문 이름 | 2'-fluoropropiophenone;2'-fluoro-1-phenylpropan-1-one;1-(2'-fluorophenyl)propan-1-one;2-Fluoropropiophenone |
| 분자식 | C9H9FO |
| 분자량 | 152.1656 |
| InChI | InChI=1/C9H9FO/c1-2-9(11)7-5-3-4-6-8(7)10/h3-6H,2H2,1H3 |
| cas번호 | 446-22-0 |
| EC번호 | 244-220-7 |
| 분자 구조 |  |
| 밀도 | 1.074g/cm3 |
| 비등점 | 204.119°C at 760 mmHg |
| 굴절 지수 | 1.489 |
| 인화점 | 77.067°C |
| 증기압 | 0.268mmHg at 25°C |
| 리스크 규칙 | R36/38##Irritating to eyes and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 