Chemindex > 4408-60-0
KR ▼
4408-60-0 2,4,6-Trimethylphenylacetic acid |
|
| 상품명칭 | 2,4,6-Trimethylphenylacetic acid |
| 영문 이름 | 2,4,6-Trimethylphenylacetic acid;Mesitylacetic acid;Mesityleneacetic acid;Mesity aceti acid;VITAS-BB TBB000369;RARECHEM AL BO 0305;BENZENEACETIC ACID, 2,4,6-TRIMETHYL-;2,4,6-TRIMETHYLBENZENEACETIC ACID;2,4,6-TMPAC;2,4,6-Trimethyl phenylacetic acid;(2,4,6-trimethylphenyl)acetate |
| 분자식 | C11H13O2 |
| 분자량 | 177.2203 |
| InChI | InChI=1/C11H14O2/c1-7-4-8(2)10(6-11(12)13)9(3)5-7/h4-5H,6H2,1-3H3,(H,12,13)/p-1 |
| cas번호 | 4408-60-0 |
| EC번호 | 224-556-0 |
| 분자 구조 |  |
| 녹는 점 | 167-168℃ |
| 비등점 | 312.9°C at 760 mmHg |
| 인화점 | 210°C |
| 증기압 | 0.000219mmHg at 25°C |
| 위험성 표시 |  Xi##Irritant:; |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.ChemNet Mall을 방문하여
2,4,6-Trimethylphenylacetic acid 4408-60-0 의 가격에 대해 문의하십시오.
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 