Chemindex > 437-17-2
KR ▼
Triphenylcarbenium hexafluorophosphate |
|
| 상품명칭 | Triphenylcarbenium hexafluorophosphate |
| 영문 이름 | Triphenylcarbenium hexafluorophosphate;Trityl hexafluorophosphate;Tritylium hexafluorophosphate;triphenylmethylium hexafluorophosphate |
| 분자량 | 243.3219 |
| InChI | InChI=1/C19H15.F6P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7(2,3,4,5)6/h1-15H;/q+1;-1 |
| cas번호 | 437-17-2 |
| EC번호 | 207-112-0 |
| 분자 구조 |  |
| 녹는 점 | 150℃ |
| 위험성 표시 |  C##Corrosive:; |
| 리스크 규칙 | R20/21##Harmful by inhalation and in contact with skin.||R34##Causes burns.:; |
| 보안 규칙 | S28##After contact with skin, wash immediately with plenty of ...:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
437-17-2 (0) 공급 업체:
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 