Chemindex > 433-53-4
KR ▼
methyl difluoroacetate |
|
| 상품명칭 | methyl difluoroacetate |
| 영문 이름 | methyl difluoroacetate;Difluoroacetic acid methyl ester;1,1,2,3,3-pentafluoroprop-1-ene;Methyl 2,2-difluoroacetate |
| 분자식 | C3HF5 |
| 분자량 | 132.0321 |
| InChI | InChI=1/C3HF5/c4-1(2(5)6)3(7)8/h2H |
| cas번호 | 433-53-4 |
| EC번호 | 207-089-7 |
| 분자 구조 |  |
| 밀도 | 1.335g/cm3 |
| 굴절 지수 | 1.264 |
| 증기압 | 2220mmHg at 25°C |
| 리스크 규칙 | R11##Highly flammable.||R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S16##Keep away from sources of ignition - No smoking.||S23##Do not inhale gas/fumes/vapour/spray.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.ChemNet Mall을 방문하여
methyl difluoroacetate 433-53-4 의 가격에 대해 문의하십시오.
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 