methyl difluoroacetate |
|
상품명칭 | methyl difluoroacetate |
영문 이름 | methyl difluoroacetate;Difluoroacetic acid methyl ester;1,1,2,3,3-pentafluoroprop-1-ene;Methyl 2,2-difluoroacetate |
분자식 | C3HF5 |
분자량 | 132.0321 |
InChI | InChI=1/C3HF5/c4-1(2(5)6)3(7)8/h2H |
cas번호 | 433-53-4 |
EC번호 | 207-089-7 |
분자 구조 | |
밀도 | 1.335g/cm3 |
굴절 지수 | 1.264 |
증기압 | 2220mmHg at 25°C |
리스크 규칙 | R11##Highly flammable.||R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S16##Keep away from sources of ignition - No smoking.||S23##Do not inhale gas/fumes/vapour/spray.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |