ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
40580-83-4 Harmol 염산염 일 수화물 |
|
상품명칭 | Harmol 염산염 일 수화물 |
별명 | ; 1- 메틸 -9H- 피리도 [3,4-b] 인돌 -7- 올 염산염 일 수화물; 1- 메틸 - 베타 - 카볼린 -7- 올 염산염 일 수화물; Harmol 염산염 이수화물; 1- 메틸 -2,9- 디 하이드로 -7H- 베타 - 카르 볼린 -7- 온 염산염 수화물; |
영문 이름 | Harmol hydrochloride monohydrate;1-Methyl-9H-pyrido[3,4-b]indol-7-ol hydrochloride monohydrate;1-methyl-beta-carbolin-7-ol hydrochloride monohydrate;Harmol hydrochloride dihydrate;1-methyl-2,9-dihydro-7H-beta-carbolin-7-one hydrochloride hydrate |
분자식 | C12H13ClN2O2 |
분자량 | 252.6968 |
InChI | InChI=1/C12H10N2O.ClH.H2O/c1-7-12-10(4-5-13-7)9-3-2-8(15)6-11(9)14-12;;/h2-6,13-14H,1H3;1H;1H2 |
cas번호 | 40580-83-4 |
EC번호 | 254-980-1 |
분자 구조 | |
비등점 | 552.7°C at 760 mmHg |
인화점 | 255°C |
증기압 | 2.94E-12mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |