ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
401-56-9 ethylchlorofluoroacetate |
|
상품명칭 | ethylchlorofluoroacetate |
영문 이름 | ethylchlorofluoroacetate;Ethyl chlorofluoroacetate;Chlorofluoroacetic acid ethyl ester;ethyl (2S)-chloro(fluoro)ethanoate;ethyl (2R)-chloro(fluoro)ethanoate |
분자식 | C4H6ClFO2 |
분자량 | 140.5406 |
InChI | InChI=1/C4H6ClFO2/c1-2-8-4(7)3(5)6/h3H,2H2,1H3/t3-/m0/s1 |
cas번호 | 401-56-9 |
EC번호 | 206-930-5 |
분자 구조 | ![]() |
밀도 | 1.219g/cm3 |
비등점 | 129°C at 760 mmHg |
굴절 지수 | 1.39 |
인화점 | 44.3°C |
증기압 | 10.4mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R34##Causes burns.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |