ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4004-95-9 1-페닐피페라진 디하이드로클로라이드 |
|
상품명칭 | 1-페닐피페라진 디하이드로클로라이드 |
별명 | 1-페닐피페라진 디하이드로클로라이드; 1-페닐피페라진 HCl |
영문 이름 | 1-phenylpiperazine dihydrochloride;1-Phenylpiperazine dihydrochloride;1-Phenylpiperazine HCl |
분자식 | C10H16Cl2N2 |
분자량 | 235.1534 |
InChI | InChI=1/C10H14N2.2ClH/c1-2-4-10(5-3-1)12-8-6-11-7-9-12;;/h1-5,11H,6-9H2;2*1H |
cas번호 | 4004-95-9 |
EC번호 | 223-654-0 |
분자 구조 | |
비등점 | 287.2°C at 760 mmHg |
인화점 | 138.3°C |
증기압 | 0.00252mmHg at 25°C |
리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |